C9H13ClN4OS — CID 63963599
3-chloro-6-hydrazinyl-N-(2-methylsulfanylethyl)pyridine-2-carboxamide (PubChem CID 63963599) has the molecular formula C9H13ClN4OS and a molecular weight of 260.75 g/mol. Its IUPAC name is 3-chloro-6-hydrazinyl-N-(2-methylsulfanylethyl)pyridine-2-carboxamide.
| Compound Name | 3-chloro-6-hydrazinyl-N-(2-methylsulfanylethyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 63963599 |
| Molecular Formula | C9H13ClN4OS |
| Molecular Weight | 260.75 g/mol |
| Exact Mass | 260.05 |
| IUPAC Name | 3-chloro-6-hydrazinyl-N-(2-methylsulfanylethyl)pyridine-2-carboxamide |
| SMILES | CSCCNC(=O)c1nc(NN)ccc1Cl |
| InChI | InChI=1S/C9H13ClN4OS/c1-16-5-4-12-9(15)8-6(10)2-3-7(13-8)14-11/h2-3H,4-5,11H2,1H3,(H,12,15)(H,13,14) |
| InChIKey | LVRBXTNMVBESNN-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.75 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|