C14H24ClN5O — CID 62248018
3-chloro-6-hydrazinyl-N-[4-[methyl(propan-2-yl)amino]butyl]pyridine-2-carboxamide (PubChem CID 62248018) has the molecular formula C14H24ClN5O and a molecular weight of 313.83 g/mol. Its IUPAC name is 3-chloro-6-hydrazinyl-N-[4-[methyl(propan-2-yl)amino]butyl]pyridine-2-carboxamide.
| Compound Name | 3-chloro-6-hydrazinyl-N-[4-[methyl(propan-2-yl)amino]butyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 62248018 |
| Molecular Formula | C14H24ClN5O |
| Molecular Weight | 313.83 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | 3-chloro-6-hydrazinyl-N-[4-[methyl(propan-2-yl)amino]butyl]pyridine-2-carboxamide |
| SMILES | CC(C)N(C)CCCCNC(=O)c1nc(NN)ccc1Cl |
| InChI | InChI=1S/C14H24ClN5O/c1-10(2)20(3)9-5-4-8-17-14(21)13-11(15)6-7-12(18-13)19-16/h6-7,10H,4-5,8-9,16H2,1-3H3,(H,17,21)(H,18,19) |
| InChIKey | NGUYPCBAJRZCQD-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 83.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.83 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|