C14H23ClN4O — CID 106050247
3-chloro-6-(methylamino)-N-[3-[methyl(propan-2-yl)amino]propyl]pyridine-2-carboxamide (PubChem CID 106050247) has the molecular formula C14H23ClN4O and a molecular weight of 298.82 g/mol. Its IUPAC name is 3-chloro-6-(methylamino)-N-[3-[methyl(propan-2-yl)amino]propyl]pyridine-2-carboxamide.
| Compound Name | 3-chloro-6-(methylamino)-N-[3-[methyl(propan-2-yl)amino]propyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 106050247 |
| Molecular Formula | C14H23ClN4O |
| Molecular Weight | 298.82 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | 3-chloro-6-(methylamino)-N-[3-[methyl(propan-2-yl)amino]propyl]pyridine-2-carboxamide |
| SMILES | CNc1ccc(Cl)c(C(=O)NCCCN(C)C(C)C)n1 |
| InChI | InChI=1S/C14H23ClN4O/c1-10(2)19(4)9-5-8-17-14(20)13-11(15)6-7-12(16-3)18-13/h6-7,10H,5,8-9H2,1-4H3,(H,16,18)(H,17,20) |
| InChIKey | YYUKGGSDZDLMIR-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.82 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|