C12H18ClN3O3 — CID 62179799
3-chloro-N-[2-(2-methoxyethoxy)ethyl]-6-(methylamino)pyridine-2-carboxamide (PubChem CID 62179799) has the molecular formula C12H18ClN3O3 and a molecular weight of 287.75 g/mol. Its IUPAC name is 3-chloro-N-[2-(2-methoxyethoxy)ethyl]-6-(methylamino)pyridine-2-carboxamide.
| Compound Name | 3-chloro-N-[2-(2-methoxyethoxy)ethyl]-6-(methylamino)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 62179799 |
| Molecular Formula | C12H18ClN3O3 |
| Molecular Weight | 287.75 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | 3-chloro-N-[2-(2-methoxyethoxy)ethyl]-6-(methylamino)pyridine-2-carboxamide |
| SMILES | CNc1ccc(Cl)c(C(=O)NCCOCCOC)n1 |
| InChI | InChI=1S/C12H18ClN3O3/c1-14-10-4-3-9(13)11(16-10)12(17)15-5-6-19-8-7-18-2/h3-4H,5-8H2,1-2H3,(H,14,16)(H,15,17) |
| InChIKey | ORCXFABQAYNAIZ-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.75 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|