C11H15ClN4O2 — CID 62170062
N-(2-acetamidoethyl)-3-chloro-6-(methylamino)pyridine-2-carboxamide (PubChem CID 62170062) has the molecular formula C11H15ClN4O2 and a molecular weight of 270.72 g/mol. Its IUPAC name is N-(2-acetamidoethyl)-3-chloro-6-(methylamino)pyridine-2-carboxamide.
| Compound Name | N-(2-acetamidoethyl)-3-chloro-6-(methylamino)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 62170062 |
| Molecular Formula | C11H15ClN4O2 |
| Molecular Weight | 270.72 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | N-(2-acetamidoethyl)-3-chloro-6-(methylamino)pyridine-2-carboxamide |
| SMILES | CNc1ccc(Cl)c(C(=O)NCCNC(C)=O)n1 |
| InChI | InChI=1S/C11H15ClN4O2/c1-7(17)14-5-6-15-11(18)10-8(12)3-4-9(13-2)16-10/h3-4H,5-6H2,1-2H3,(H,13,16)(H,14,17)(H,15,18) |
| InChIKey | RNJRECPPYGYWFL-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.72 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|