C11H13ClF3N3OS — CID 106432994
3-chloro-6-(ethylamino)-N-[2-(trifluoromethylsulfanyl)ethyl]pyridine-2-carboxamide (PubChem CID 106432994) has the molecular formula C11H13ClF3N3OS and a molecular weight of 327.76 g/mol. Its IUPAC name is 3-chloro-6-(ethylamino)-N-[2-(trifluoromethylsulfanyl)ethyl]pyridine-2-carboxamide.
| Compound Name | 3-chloro-6-(ethylamino)-N-[2-(trifluoromethylsulfanyl)ethyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 106432994 |
| Molecular Formula | C11H13ClF3N3OS |
| Molecular Weight | 327.76 g/mol |
| Exact Mass | 327.04 |
| IUPAC Name | 3-chloro-6-(ethylamino)-N-[2-(trifluoromethylsulfanyl)ethyl]pyridine-2-carboxamide |
| SMILES | CCNc1ccc(Cl)c(C(=O)NCCSC(F)(F)F)n1 |
| InChI | InChI=1S/C11H13ClF3N3OS/c1-2-16-8-4-3-7(12)9(18-8)10(19)17-5-6-20-11(13,14)15/h3-4H,2,5-6H2,1H3,(H,16,18)(H,17,19) |
| InChIKey | GEMLGJYVAYNJPW-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.76 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|