C13H11Cl3N4O — CID 62237587
3-chloro-N-(2,6-dichloro-3-methylphenyl)-6-hydrazinylpyridine-2-carboxamide (PubChem CID 62237587) has the molecular formula C13H11Cl3N4O and a molecular weight of 345.62 g/mol. Its IUPAC name is 3-chloro-N-(2,6-dichloro-3-methylphenyl)-6-hydrazinylpyridine-2-carboxamide.
| Compound Name | 3-chloro-N-(2,6-dichloro-3-methylphenyl)-6-hydrazinylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 62237587 |
| Molecular Formula | C13H11Cl3N4O |
| Molecular Weight | 345.62 g/mol |
| Exact Mass | 344.00 |
| IUPAC Name | 3-chloro-N-(2,6-dichloro-3-methylphenyl)-6-hydrazinylpyridine-2-carboxamide |
| SMILES | Cc1ccc(Cl)c(NC(=O)c2nc(NN)ccc2Cl)c1Cl |
| InChI | InChI=1S/C13H11Cl3N4O/c1-6-2-3-7(14)11(10(6)16)19-13(21)12-8(15)4-5-9(18-12)20-17/h2-5H,17H2,1H3,(H,18,20)(H,19,21) |
| InChIKey | KZEKYVJLIWAFSE-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.62 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|