C12H8ClF3N4O — CID 62237965
3-chloro-6-hydrazinyl-N-(2,3,4-trifluorophenyl)pyridine-2-carboxamide (PubChem CID 62237965) has the molecular formula C12H8ClF3N4O and a molecular weight of 316.67 g/mol. Its IUPAC name is 3-chloro-6-hydrazinyl-N-(2,3,4-trifluorophenyl)pyridine-2-carboxamide.
| Compound Name | 3-chloro-6-hydrazinyl-N-(2,3,4-trifluorophenyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 62237965 |
| Molecular Formula | C12H8ClF3N4O |
| Molecular Weight | 316.67 g/mol |
| Exact Mass | 316.03 |
| IUPAC Name | 3-chloro-6-hydrazinyl-N-(2,3,4-trifluorophenyl)pyridine-2-carboxamide |
| SMILES | NNc1ccc(Cl)c(C(=O)Nc2ccc(F)c(F)c2F)n1 |
| InChI | InChI=1S/C12H8ClF3N4O/c13-5-1-4-8(20-17)19-11(5)12(21)18-7-3-2-6(14)9(15)10(7)16/h1-4H,17H2,(H,18,21)(H,19,20) |
| InChIKey | NWPBGTDQKRNYFR-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.67 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|