C12H8Cl3FN4O — CID 107578975
3-chloro-N-(3,5-dichloro-4-fluorophenyl)-6-hydrazinylpyridine-2-carboxamide (PubChem CID 107578975) has the molecular formula C12H8Cl3FN4O and a molecular weight of 349.58 g/mol. Its IUPAC name is 3-chloro-N-(3,5-dichloro-4-fluorophenyl)-6-hydrazinylpyridine-2-carboxamide.
| Compound Name | 3-chloro-N-(3,5-dichloro-4-fluorophenyl)-6-hydrazinylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 107578975 |
| Molecular Formula | C12H8Cl3FN4O |
| Molecular Weight | 349.58 g/mol |
| Exact Mass | 347.97 |
| IUPAC Name | 3-chloro-N-(3,5-dichloro-4-fluorophenyl)-6-hydrazinylpyridine-2-carboxamide |
| SMILES | NNc1ccc(Cl)c(C(=O)Nc2cc(Cl)c(F)c(Cl)c2)n1 |
| InChI | InChI=1S/C12H8Cl3FN4O/c13-6-1-2-9(20-17)19-11(6)12(21)18-5-3-7(14)10(16)8(15)4-5/h1-4H,17H2,(H,18,21)(H,19,20) |
| InChIKey | PQYBSZYKOZVVPC-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.58 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|