C11H8Cl2FN5O — CID 107578968
N-(3,5-dichloro-4-fluorophenyl)-6-hydrazinylpyridazine-3-carboxamide (PubChem CID 107578968) has the molecular formula C11H8Cl2FN5O and a molecular weight of 316.12 g/mol. Its IUPAC name is N-(3,5-dichloro-4-fluorophenyl)-6-hydrazinylpyridazine-3-carboxamide.
| Compound Name | N-(3,5-dichloro-4-fluorophenyl)-6-hydrazinylpyridazine-3-carboxamide |
|---|---|
| PubChem CID | 107578968 |
| Molecular Formula | C11H8Cl2FN5O |
| Molecular Weight | 316.12 g/mol |
| Exact Mass | 315.01 |
| IUPAC Name | N-(3,5-dichloro-4-fluorophenyl)-6-hydrazinylpyridazine-3-carboxamide |
| SMILES | NNc1ccc(C(=O)Nc2cc(Cl)c(F)c(Cl)c2)nn1 |
| InChI | InChI=1S/C11H8Cl2FN5O/c12-6-3-5(4-7(13)10(6)14)16-11(20)8-1-2-9(17-15)19-18-8/h1-4H,15H2,(H,16,20)(H,17,19) |
| InChIKey | QVPBCGFNHDWQSX-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.12 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|