C11H9F2N5O — CID 62247776
N-(2,4-difluorophenyl)-6-hydrazinylpyridazine-3-carboxamide (PubChem CID 62247776) has the molecular formula C11H9F2N5O and a molecular weight of 265.22 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-6-hydrazinylpyridazine-3-carboxamide.
| Compound Name | N-(2,4-difluorophenyl)-6-hydrazinylpyridazine-3-carboxamide |
|---|---|
| PubChem CID | 62247776 |
| Molecular Formula | C11H9F2N5O |
| Molecular Weight | 265.22 g/mol |
| Exact Mass | 265.08 |
| IUPAC Name | N-(2,4-difluorophenyl)-6-hydrazinylpyridazine-3-carboxamide |
| SMILES | NNc1ccc(C(=O)Nc2ccc(F)cc2F)nn1 |
| InChI | InChI=1S/C11H9F2N5O/c12-6-1-2-8(7(13)5-6)15-11(19)9-3-4-10(16-14)18-17-9/h1-5H,14H2,(H,15,19)(H,16,18) |
| InChIKey | RJUADQRILLKNTO-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.22 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|