C11H8BrF2N5O — CID 107616833
N-(4-bromo-2,5-difluorophenyl)-6-hydrazinylpyridazine-3-carboxamide (PubChem CID 107616833) has the molecular formula C11H8BrF2N5O and a molecular weight of 344.12 g/mol. Its IUPAC name is N-(4-bromo-2,5-difluorophenyl)-6-hydrazinylpyridazine-3-carboxamide.
| Compound Name | N-(4-bromo-2,5-difluorophenyl)-6-hydrazinylpyridazine-3-carboxamide |
|---|---|
| PubChem CID | 107616833 |
| Molecular Formula | C11H8BrF2N5O |
| Molecular Weight | 344.12 g/mol |
| Exact Mass | 342.99 |
| IUPAC Name | N-(4-bromo-2,5-difluorophenyl)-6-hydrazinylpyridazine-3-carboxamide |
| SMILES | NNc1ccc(C(=O)Nc2cc(F)c(Br)cc2F)nn1 |
| InChI | InChI=1S/C11H8BrF2N5O/c12-5-3-7(14)9(4-6(5)13)16-11(20)8-1-2-10(17-15)19-18-8/h1-4H,15H2,(H,16,20)(H,17,19) |
| InChIKey | SUQAJEQQOVAHFA-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.12 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|