C13H6Br2ClF2NO — CID 103842628
5-bromo-N-(4-bromo-2,5-difluorophenyl)-2-chlorobenzamide (PubChem CID 103842628) has the molecular formula C13H6Br2ClF2NO and a molecular weight of 425.45 g/mol. Its IUPAC name is 5-bromo-N-(4-bromo-2,5-difluorophenyl)-2-chlorobenzamide.
| Compound Name | 5-bromo-N-(4-bromo-2,5-difluorophenyl)-2-chlorobenzamide |
|---|---|
| PubChem CID | 103842628 |
| Molecular Formula | C13H6Br2ClF2NO |
| Molecular Weight | 425.45 g/mol |
| Exact Mass | 422.85 |
| IUPAC Name | 5-bromo-N-(4-bromo-2,5-difluorophenyl)-2-chlorobenzamide |
| SMILES | O=C(Nc1cc(F)c(Br)cc1F)c1cc(Br)ccc1Cl |
| InChI | InChI=1S/C13H6Br2ClF2NO/c14-6-1-2-9(16)7(3-6)13(20)19-12-5-10(17)8(15)4-11(12)18/h1-5H,(H,19,20) |
| InChIKey | YQBIIAUIEKCSAQ-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.45 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|