C13H6BrCl3FNO — CID 28547728
5-bromo-2-fluoro-N-(2,4,5-trichlorophenyl)benzamide (PubChem CID 28547728) has the molecular formula C13H6BrCl3FNO and a molecular weight of 397.46 g/mol. Its IUPAC name is 5-bromo-2-fluoro-N-(2,4,5-trichlorophenyl)benzamide.
| Compound Name | 5-bromo-2-fluoro-N-(2,4,5-trichlorophenyl)benzamide |
|---|---|
| PubChem CID | 28547728 |
| Molecular Formula | C13H6BrCl3FNO |
| Molecular Weight | 397.46 g/mol |
| Exact Mass | 394.87 |
| IUPAC Name | 5-bromo-2-fluoro-N-(2,4,5-trichlorophenyl)benzamide |
| SMILES | O=C(Nc1cc(Cl)c(Cl)cc1Cl)c1cc(Br)ccc1F |
| InChI | InChI=1S/C13H6BrCl3FNO/c14-6-1-2-11(18)7(3-6)13(20)19-12-5-9(16)8(15)4-10(12)17/h1-5H,(H,19,20) |
| InChIKey | ZRBXAASIJBTQCH-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.46 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|