C12H5BrCl2F2N2O — CID 103842592
N-(4-bromo-2,5-difluorophenyl)-3,6-dichloropyridine-2-carboxamide (PubChem CID 103842592) has the molecular formula C12H5BrCl2F2N2O and a molecular weight of 381.99 g/mol. Its IUPAC name is N-(4-bromo-2,5-difluorophenyl)-3,6-dichloropyridine-2-carboxamide.
| Compound Name | N-(4-bromo-2,5-difluorophenyl)-3,6-dichloropyridine-2-carboxamide |
|---|---|
| PubChem CID | 103842592 |
| Molecular Formula | C12H5BrCl2F2N2O |
| Molecular Weight | 381.99 g/mol |
| Exact Mass | 379.89 |
| IUPAC Name | N-(4-bromo-2,5-difluorophenyl)-3,6-dichloropyridine-2-carboxamide |
| SMILES | O=C(Nc1cc(F)c(Br)cc1F)c1nc(Cl)ccc1Cl |
| InChI | InChI=1S/C12H5BrCl2F2N2O/c13-5-3-8(17)9(4-7(5)16)18-12(20)11-6(14)1-2-10(15)19-11/h1-4H,(H,18,20) |
| InChIKey | WGHKYCKWTBTGHX-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.99 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|