C12H9FN6O — CID 62235962
N-(2-cyano-3-fluorophenyl)-6-hydrazinylpyridazine-3-carboxamide (PubChem CID 62235962) has the molecular formula C12H9FN6O and a molecular weight of 272.24 g/mol. Its IUPAC name is N-(2-cyano-3-fluorophenyl)-6-hydrazinylpyridazine-3-carboxamide.
| Compound Name | N-(2-cyano-3-fluorophenyl)-6-hydrazinylpyridazine-3-carboxamide |
|---|---|
| PubChem CID | 62235962 |
| Molecular Formula | C12H9FN6O |
| Molecular Weight | 272.24 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | N-(2-cyano-3-fluorophenyl)-6-hydrazinylpyridazine-3-carboxamide |
| SMILES | N#Cc1c(F)cccc1NC(=O)c1ccc(NN)nn1 |
| InChI | InChI=1S/C12H9FN6O/c13-8-2-1-3-9(7(8)6-14)16-12(20)10-4-5-11(17-15)19-18-10/h1-5H,15H2,(H,16,20)(H,17,19) |
| InChIKey | XOZNLNYSTDEWMT-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 116.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.24 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|