C11H7BrF2N4O — CID 107616540
5-amino-N-(4-bromo-2,5-difluorophenyl)pyrazine-2-carboxamide (PubChem CID 107616540) has the molecular formula C11H7BrF2N4O and a molecular weight of 329.10 g/mol. Its IUPAC name is 5-amino-N-(4-bromo-2,5-difluorophenyl)pyrazine-2-carboxamide.
| Compound Name | 5-amino-N-(4-bromo-2,5-difluorophenyl)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 107616540 |
| Molecular Formula | C11H7BrF2N4O |
| Molecular Weight | 329.10 g/mol |
| Exact Mass | 327.98 |
| IUPAC Name | 5-amino-N-(4-bromo-2,5-difluorophenyl)pyrazine-2-carboxamide |
| SMILES | Nc1cnc(C(=O)Nc2cc(F)c(Br)cc2F)cn1 |
| InChI | InChI=1S/C11H7BrF2N4O/c12-5-1-7(14)8(2-6(5)13)18-11(19)9-3-17-10(15)4-16-9/h1-4H,(H2,15,17)(H,18,19) |
| InChIKey | SJEUDZIZTSWYDK-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.10 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|