C11H7Br3N4O — CID 107374395
5-amino-N-(2,4,6-tribromophenyl)pyrazine-2-carboxamide (PubChem CID 107374395) has the molecular formula C11H7Br3N4O and a molecular weight of 450.92 g/mol. Its IUPAC name is 5-amino-N-(2,4,6-tribromophenyl)pyrazine-2-carboxamide.
| Compound Name | 5-amino-N-(2,4,6-tribromophenyl)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 107374395 |
| Molecular Formula | C11H7Br3N4O |
| Molecular Weight | 450.92 g/mol |
| Exact Mass | 447.82 |
| IUPAC Name | 5-amino-N-(2,4,6-tribromophenyl)pyrazine-2-carboxamide |
| SMILES | Nc1cnc(C(=O)Nc2c(Br)cc(Br)cc2Br)cn1 |
| InChI | InChI=1S/C11H7Br3N4O/c12-5-1-6(13)10(7(14)2-5)18-11(19)8-3-17-9(15)4-16-8/h1-4H,(H2,15,17)(H,18,19) |
| InChIKey | ZMKVKAQYHQIESS-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.92 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |