C12H8BrF2N3O — CID 107616547
4-amino-N-(4-bromo-2,5-difluorophenyl)pyridine-3-carboxamide (PubChem CID 107616547) has the molecular formula C12H8BrF2N3O and a molecular weight of 328.12 g/mol. Its IUPAC name is 4-amino-N-(4-bromo-2,5-difluorophenyl)pyridine-3-carboxamide.
| Compound Name | 4-amino-N-(4-bromo-2,5-difluorophenyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 107616547 |
| Molecular Formula | C12H8BrF2N3O |
| Molecular Weight | 328.12 g/mol |
| Exact Mass | 326.98 |
| IUPAC Name | 4-amino-N-(4-bromo-2,5-difluorophenyl)pyridine-3-carboxamide |
| SMILES | Nc1ccncc1C(=O)Nc1cc(F)c(Br)cc1F |
| InChI | InChI=1S/C12H8BrF2N3O/c13-7-3-9(15)11(4-8(7)14)18-12(19)6-5-17-2-1-10(6)16/h1-5H,(H2,16,17)(H,18,19) |
| InChIKey | GFQQJIAYMBMLBG-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.12 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|