C12H7BrF3N3O — CID 102854918
2-amino-N-(5-bromo-2,4-difluorophenyl)-3-fluoropyridine-4-carboxamide (PubChem CID 102854918) has the molecular formula C12H7BrF3N3O and a molecular weight of 346.11 g/mol. Its IUPAC name is 2-amino-N-(5-bromo-2,4-difluorophenyl)-3-fluoropyridine-4-carboxamide.
| Compound Name | 2-amino-N-(5-bromo-2,4-difluorophenyl)-3-fluoropyridine-4-carboxamide |
|---|---|
| PubChem CID | 102854918 |
| Molecular Formula | C12H7BrF3N3O |
| Molecular Weight | 346.11 g/mol |
| Exact Mass | 344.97 |
| IUPAC Name | 2-amino-N-(5-bromo-2,4-difluorophenyl)-3-fluoropyridine-4-carboxamide |
| SMILES | Nc1nccc(C(=O)Nc2cc(Br)c(F)cc2F)c1F |
| InChI | InChI=1S/C12H7BrF3N3O/c13-6-3-9(8(15)4-7(6)14)19-12(20)5-1-2-18-11(17)10(5)16/h1-4H,(H2,17,18)(H,19,20) |
| InChIKey | PPZKXLXTDNWYRY-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.11 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|