C13H7BrF2INO — CID 103842493
N-(4-bromo-2,5-difluorophenyl)-2-iodobenzamide (PubChem CID 103842493) has the molecular formula C13H7BrF2INO and a molecular weight of 438.01 g/mol. Its IUPAC name is N-(4-bromo-2,5-difluorophenyl)-2-iodobenzamide.
| Compound Name | N-(4-bromo-2,5-difluorophenyl)-2-iodobenzamide |
|---|---|
| PubChem CID | 103842493 |
| Molecular Formula | C13H7BrF2INO |
| Molecular Weight | 438.01 g/mol |
| Exact Mass | 436.87 |
| IUPAC Name | N-(4-bromo-2,5-difluorophenyl)-2-iodobenzamide |
| SMILES | O=C(Nc1cc(F)c(Br)cc1F)c1ccccc1I |
| InChI | InChI=1S/C13H7BrF2INO/c14-8-5-10(16)12(6-9(8)15)18-13(19)7-3-1-2-4-11(7)17/h1-6H,(H,18,19) |
| InChIKey | KPVPTBKEPSKICV-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.01 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|