C11H6BrF2N3O3 — CID 107612322
N-(4-bromo-2,5-difluorophenyl)-2,4-dioxo-1H-pyrimidine-5-carboxamide (PubChem CID 107612322) has the molecular formula C11H6BrF2N3O3 and a molecular weight of 346.09 g/mol. Its IUPAC name is N-(4-bromo-2,5-difluorophenyl)-2,4-dioxo-1H-pyrimidine-5-carboxamide.
| Compound Name | N-(4-bromo-2,5-difluorophenyl)-2,4-dioxo-1H-pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 107612322 |
| Molecular Formula | C11H6BrF2N3O3 |
| Molecular Weight | 346.09 g/mol |
| Exact Mass | 344.96 |
| IUPAC Name | N-(4-bromo-2,5-difluorophenyl)-2,4-dioxo-1H-pyrimidine-5-carboxamide |
| SMILES | O=C(Nc1cc(F)c(Br)cc1F)c1c[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C11H6BrF2N3O3/c12-5-1-7(14)8(2-6(5)13)16-9(18)4-3-15-11(20)17-10(4)19/h1-3H,(H,16,18)(H2,15,17,19,20) |
| InChIKey | MHTRLDCWAQFOPT-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 94.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.09 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|