C12H7BrF2N2O2 — CID 103842478
N-(4-bromo-2,5-difluorophenyl)-6-oxo-1H-pyridine-3-carboxamide (PubChem CID 103842478) has the molecular formula C12H7BrF2N2O2 and a molecular weight of 329.10 g/mol. Its IUPAC name is N-(4-bromo-2,5-difluorophenyl)-6-oxo-1H-pyridine-3-carboxamide.
| Compound Name | N-(4-bromo-2,5-difluorophenyl)-6-oxo-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 103842478 |
| Molecular Formula | C12H7BrF2N2O2 |
| Molecular Weight | 329.10 g/mol |
| Exact Mass | 327.97 |
| IUPAC Name | N-(4-bromo-2,5-difluorophenyl)-6-oxo-1H-pyridine-3-carboxamide |
| SMILES | O=C(Nc1cc(F)c(Br)cc1F)c1ccc(=O)[nH]c1 |
| InChI | InChI=1S/C12H7BrF2N2O2/c13-7-3-9(15)10(4-8(7)14)17-12(19)6-1-2-11(18)16-5-6/h1-5H,(H,16,18)(H,17,19) |
| InChIKey | CAMRZJKIPZCKGM-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.10 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|