C12H8BrFN2O2 — CID 65435783
N-(4-bromo-3-fluorophenyl)-6-oxo-1H-pyridine-3-carboxamide (PubChem CID 65435783) has the molecular formula C12H8BrFN2O2 and a molecular weight of 311.11 g/mol. Its IUPAC name is N-(4-bromo-3-fluorophenyl)-6-oxo-1H-pyridine-3-carboxamide.
| Compound Name | N-(4-bromo-3-fluorophenyl)-6-oxo-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 65435783 |
| Molecular Formula | C12H8BrFN2O2 |
| Molecular Weight | 311.11 g/mol |
| Exact Mass | 309.98 |
| IUPAC Name | N-(4-bromo-3-fluorophenyl)-6-oxo-1H-pyridine-3-carboxamide |
| SMILES | O=C(Nc1ccc(Br)c(F)c1)c1ccc(=O)[nH]c1 |
| InChI | InChI=1S/C12H8BrFN2O2/c13-9-3-2-8(5-10(9)14)16-12(18)7-1-4-11(17)15-6-7/h1-6H,(H,15,17)(H,16,18) |
| InChIKey | XKGRICONWGPOSI-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.11 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |