C11H7BrFN3O3 — CID 65430680
N-(4-bromo-3-fluorophenyl)-2,4-dioxo-1H-pyrimidine-5-carboxamide (PubChem CID 65430680) has the molecular formula C11H7BrFN3O3 and a molecular weight of 328.10 g/mol. Its IUPAC name is N-(4-bromo-3-fluorophenyl)-2,4-dioxo-1H-pyrimidine-5-carboxamide.
| Compound Name | N-(4-bromo-3-fluorophenyl)-2,4-dioxo-1H-pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 65430680 |
| Molecular Formula | C11H7BrFN3O3 |
| Molecular Weight | 328.10 g/mol |
| Exact Mass | 326.97 |
| IUPAC Name | N-(4-bromo-3-fluorophenyl)-2,4-dioxo-1H-pyrimidine-5-carboxamide |
| SMILES | O=C(Nc1ccc(Br)c(F)c1)c1c[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C11H7BrFN3O3/c12-7-2-1-5(3-8(7)13)15-9(17)6-4-14-11(19)16-10(6)18/h1-4H,(H,15,17)(H2,14,16,18,19) |
| InChIKey | VRMDNGWISYLBJF-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 94.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.10 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |