C15H11FN2O3 — CID 65434489
N-[3-fluoro-4-(3-hydroxyprop-1-ynyl)phenyl]-6-oxo-1H-pyridine-3-carboxamide (PubChem CID 65434489) has the molecular formula C15H11FN2O3 and a molecular weight of 286.26 g/mol. Its IUPAC name is N-[3-fluoro-4-(3-hydroxyprop-1-ynyl)phenyl]-6-oxo-1H-pyridine-3-carboxamide.
| Compound Name | N-[3-fluoro-4-(3-hydroxyprop-1-ynyl)phenyl]-6-oxo-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 65434489 |
| Molecular Formula | C15H11FN2O3 |
| Molecular Weight | 286.26 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | N-[3-fluoro-4-(3-hydroxyprop-1-ynyl)phenyl]-6-oxo-1H-pyridine-3-carboxamide |
| SMILES | O=C(Nc1ccc(C#CCO)c(F)c1)c1ccc(=O)[nH]c1 |
| InChI | InChI=1S/C15H11FN2O3/c16-13-8-12(5-3-10(13)2-1-7-19)18-15(21)11-4-6-14(20)17-9-11/h3-6,8-9,19H,7H2,(H,17,20)(H,18,21) |
| InChIKey | BUYSBVRDLAVYOS-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.26 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|