C16H13FN2O2 — CID 65435087
N-[3-fluoro-4-(4-hydroxybut-1-ynyl)phenyl]pyridine-4-carboxamide (PubChem CID 65435087) has the molecular formula C16H13FN2O2 and a molecular weight of 284.29 g/mol. Its IUPAC name is N-[3-fluoro-4-(4-hydroxybut-1-ynyl)phenyl]pyridine-4-carboxamide.
| Compound Name | N-[3-fluoro-4-(4-hydroxybut-1-ynyl)phenyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 65435087 |
| Molecular Formula | C16H13FN2O2 |
| Molecular Weight | 284.29 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | N-[3-fluoro-4-(4-hydroxybut-1-ynyl)phenyl]pyridine-4-carboxamide |
| SMILES | O=C(Nc1ccc(C#CCCO)c(F)c1)c1ccncc1 |
| InChI | InChI=1S/C16H13FN2O2/c17-15-11-14(5-4-12(15)3-1-2-10-20)19-16(21)13-6-8-18-9-7-13/h4-9,11,20H,2,10H2,(H,19,21) |
| InChIKey | AWFBHNQRTFPQEP-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.29 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|