C15H12FN3O2 — CID 102922448
N-[4-fluoro-3-(4-hydroxybut-1-ynyl)phenyl]pyrimidine-5-carboxamide (PubChem CID 102922448) has the molecular formula C15H12FN3O2 and a molecular weight of 285.28 g/mol. Its IUPAC name is N-[4-fluoro-3-(4-hydroxybut-1-ynyl)phenyl]pyrimidine-5-carboxamide.
| Compound Name | N-[4-fluoro-3-(4-hydroxybut-1-ynyl)phenyl]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 102922448 |
| Molecular Formula | C15H12FN3O2 |
| Molecular Weight | 285.28 g/mol |
| Exact Mass | 285.09 |
| IUPAC Name | N-[4-fluoro-3-(4-hydroxybut-1-ynyl)phenyl]pyrimidine-5-carboxamide |
| SMILES | O=C(Nc1ccc(F)c(C#CCCO)c1)c1cncnc1 |
| InChI | InChI=1S/C15H12FN3O2/c16-14-5-4-13(7-11(14)3-1-2-6-20)19-15(21)12-8-17-10-18-9-12/h4-5,7-10,20H,2,6H2,(H,19,21) |
| InChIKey | ZAROFAGXUSNOGW-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.28 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|