C14H11FN2O3 — CID 62904657
3-fluoro-4-(4-hydroxybut-1-ynyl)-N-(1,2-oxazol-3-yl)benzamide (PubChem CID 62904657) has the molecular formula C14H11FN2O3 and a molecular weight of 274.25 g/mol. Its IUPAC name is 3-fluoro-4-(4-hydroxybut-1-ynyl)-N-(1,2-oxazol-3-yl)benzamide.
| Compound Name | 3-fluoro-4-(4-hydroxybut-1-ynyl)-N-(1,2-oxazol-3-yl)benzamide |
|---|---|
| PubChem CID | 62904657 |
| Molecular Formula | C14H11FN2O3 |
| Molecular Weight | 274.25 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | 3-fluoro-4-(4-hydroxybut-1-ynyl)-N-(1,2-oxazol-3-yl)benzamide |
| SMILES | O=C(Nc1ccon1)c1ccc(C#CCCO)c(F)c1 |
| InChI | InChI=1S/C14H11FN2O3/c15-12-9-11(5-4-10(12)3-1-2-7-18)14(19)16-13-6-8-20-17-13/h4-6,8-9,18H,2,7H2,(H,16,17,19) |
| InChIKey | WKFKXVRHJWURNM-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.25 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|