C13H10FN3O2S — CID 65432952
N-[3-fluoro-4-(3-hydroxyprop-1-ynyl)phenyl]-4-methylthiadiazole-5-carboxamide (PubChem CID 65432952) has the molecular formula C13H10FN3O2S and a molecular weight of 291.31 g/mol. Its IUPAC name is N-[3-fluoro-4-(3-hydroxyprop-1-ynyl)phenyl]-4-methylthiadiazole-5-carboxamide.
| Compound Name | N-[3-fluoro-4-(3-hydroxyprop-1-ynyl)phenyl]-4-methylthiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 65432952 |
| Molecular Formula | C13H10FN3O2S |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.05 |
| IUPAC Name | N-[3-fluoro-4-(3-hydroxyprop-1-ynyl)phenyl]-4-methylthiadiazole-5-carboxamide |
| SMILES | Cc1nnsc1C(=O)Nc1ccc(C#CCO)c(F)c1 |
| InChI | InChI=1S/C13H10FN3O2S/c1-8-12(20-17-16-8)13(19)15-10-5-4-9(3-2-6-18)11(14)7-10/h4-5,7,18H,6H2,1H3,(H,15,19) |
| InChIKey | BOJZOMLTYYJXGF-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|