C14H13N3O2S — CID 82767195
N-[2-(3-hydroxyprop-1-ynyl)-5-methylphenyl]-4-methylthiadiazole-5-carboxamide (PubChem CID 82767195) has the molecular formula C14H13N3O2S and a molecular weight of 287.34 g/mol. Its IUPAC name is N-[2-(3-hydroxyprop-1-ynyl)-5-methylphenyl]-4-methylthiadiazole-5-carboxamide.
| Compound Name | N-[2-(3-hydroxyprop-1-ynyl)-5-methylphenyl]-4-methylthiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 82767195 |
| Molecular Formula | C14H13N3O2S |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.07 |
| IUPAC Name | N-[2-(3-hydroxyprop-1-ynyl)-5-methylphenyl]-4-methylthiadiazole-5-carboxamide |
| SMILES | Cc1ccc(C#CCO)c(NC(=O)c2snnc2C)c1 |
| InChI | InChI=1S/C14H13N3O2S/c1-9-5-6-11(4-3-7-18)12(8-9)15-14(19)13-10(2)16-17-20-13/h5-6,8,18H,7H2,1-2H3,(H,15,19) |
| InChIKey | JIXRRKWMTPHWBX-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|