C11H10N4O3 — CID 43599993
N-(2-aminophenyl)-2,4-dioxo-1H-pyrimidine-5-carboxamide (PubChem CID 43599993) has the molecular formula C11H10N4O3 and a molecular weight of 246.23 g/mol. Its IUPAC name is N-(2-aminophenyl)-2,4-dioxo-1H-pyrimidine-5-carboxamide.
| Compound Name | N-(2-aminophenyl)-2,4-dioxo-1H-pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 43599993 |
| Molecular Formula | C11H10N4O3 |
| Molecular Weight | 246.23 g/mol |
| Exact Mass | 246.08 |
| IUPAC Name | N-(2-aminophenyl)-2,4-dioxo-1H-pyrimidine-5-carboxamide |
| SMILES | Nc1ccccc1NC(=O)c1c[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C11H10N4O3/c12-7-3-1-2-4-8(7)14-9(16)6-5-13-11(18)15-10(6)17/h1-5H,12H2,(H,14,16)(H2,13,15,17,18) |
| InChIKey | OEZXNTBVCOIHGI-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 120.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.23 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|