C7H10N4O3 — CID 60965324
N-(2-aminoethyl)-2,4-dioxo-1H-pyrimidine-5-carboxamide (PubChem CID 60965324) has the molecular formula C7H10N4O3 and a molecular weight of 198.18 g/mol. Its IUPAC name is N-(2-aminoethyl)-2,4-dioxo-1H-pyrimidine-5-carboxamide.
| Compound Name | N-(2-aminoethyl)-2,4-dioxo-1H-pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 60965324 |
| Molecular Formula | C7H10N4O3 |
| Molecular Weight | 198.18 g/mol |
| Exact Mass | 198.08 |
| IUPAC Name | N-(2-aminoethyl)-2,4-dioxo-1H-pyrimidine-5-carboxamide |
| SMILES | NCCNC(=O)c1c[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C7H10N4O3/c8-1-2-9-5(12)4-3-10-7(14)11-6(4)13/h3H,1-2,8H2,(H,9,12)(H2,10,11,13,14) |
| InChIKey | LHZKNWYRNGAXNI-UHFFFAOYSA-N |
| XLogP | -2.25 |
| TPSA | 120.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.18 |
| LogP ≤ 5 | -2.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |