C11H8ClN3O4 — CID 64786362
N-(2-chloro-4-hydroxyphenyl)-2,4-dioxo-1H-pyrimidine-5-carboxamide (PubChem CID 64786362) has the molecular formula C11H8ClN3O4 and a molecular weight of 281.66 g/mol. Its IUPAC name is N-(2-chloro-4-hydroxyphenyl)-2,4-dioxo-1H-pyrimidine-5-carboxamide.
| Compound Name | N-(2-chloro-4-hydroxyphenyl)-2,4-dioxo-1H-pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 64786362 |
| Molecular Formula | C11H8ClN3O4 |
| Molecular Weight | 281.66 g/mol |
| Exact Mass | 281.02 |
| IUPAC Name | N-(2-chloro-4-hydroxyphenyl)-2,4-dioxo-1H-pyrimidine-5-carboxamide |
| SMILES | O=C(Nc1ccc(O)cc1Cl)c1c[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C11H8ClN3O4/c12-7-3-5(16)1-2-8(7)14-9(17)6-4-13-11(19)15-10(6)18/h1-4,16H,(H,14,17)(H2,13,15,18,19) |
| InChIKey | BWLUGBGOINOFRV-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 115.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.66 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|