2-[(2,4-dioxo-1H-pyrimidine-5-carbonyl)amino]benzoic acid

C12H9N3O5 — CID 28773270

IUPAC2-[(2,4-dioxo-1H-pyrimidine-5-carbonyl)amino]benzoic acid
SMILESO=C(O)c1ccccc1NC(=O)c1c[nH]c(=O)[nH]c1=O
InChIInChI=1S/C12H9N3O5/c16-9(7-5-13-12(20)15-10(7)17)14-8-4-2-1-3-6(8)11(18)19/h1-5H,(H,14,16)(H,18,19)(H2,13,15,17,20)
InChIKeyCACNKYQYHCNVIJ-UHFFFAOYSA-N
MW275.22 g/mol
LogP0.01
Rot. Bonds3

About 2-[(2,4-dioxo-1H-pyrimidine-5-carbonyl)amino]benzoic acid

2-[(2,4-dioxo-1H-pyrimidine-5-carbonyl)amino]benzoic acid (PubChem CID 28773270) has the molecular formula C12H9N3O5 and a molecular weight of 275.22 g/mol. Its IUPAC name is 2-[(2,4-dioxo-1H-pyrimidine-5-carbonyl)amino]benzoic acid.

Molecular Properties

Compound Name2-[(2,4-dioxo-1H-pyrimidine-5-carbonyl)amino]benzoic acid
PubChem CID28773270
Molecular FormulaC12H9N3O5
Molecular Weight275.22 g/mol
Exact Mass275.05
IUPAC Name2-[(2,4-dioxo-1H-pyrimidine-5-carbonyl)amino]benzoic acid
SMILESO=C(O)c1ccccc1NC(=O)c1c[nH]c(=O)[nH]c1=O
InChIInChI=1S/C12H9N3O5/c16-9(7-5-13-12(20)15-10(7)17)14-8-4-2-1-3-6(8)11(18)19/h1-5H,(H,14,16)(H,18,19)(H2,13,15,17,20)
InChIKeyCACNKYQYHCNVIJ-UHFFFAOYSA-N
XLogP0.01
TPSA132.12 Ų
H-Bond Donors4
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500275.22
LogP ≤ 50.01
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 104

Analyze 2-[(2,4-dioxo-1H-pyrimidine-5-carbonyl)amino]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(2,4-dioxo-1H-pyrimidine-5-carbonyl)amino]benzoic acid?
The IUPAC name of 2-[(2,4-dioxo-1H-pyrimidine-5-carbonyl)amino]benzoic acid (CID 28773270) is 2-[(2,4-dioxo-1H-pyrimidine-5-carbonyl)amino]benzoic acid.
What is the SMILES notation for 2-[(2,4-dioxo-1H-pyrimidine-5-carbonyl)amino]benzoic acid?
The canonical SMILES for 2-[(2,4-dioxo-1H-pyrimidine-5-carbonyl)amino]benzoic acid is O=C(O)c1ccccc1NC(=O)c1c[nH]c(=O)[nH]c1=O.
What is the InChIKey of 2-[(2,4-dioxo-1H-pyrimidine-5-carbonyl)amino]benzoic acid?
The InChIKey is CACNKYQYHCNVIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9N3O5/c16-9(7-5-13-12(20)15-10(7)17)14-8-4-2-1-3-6(8)11(18)19/h1-5H,(H,14,16)(H,18,19)(H2,13,15,17,20).
What are the key properties of 2-[(2,4-dioxo-1H-pyrimidine-5-carbonyl)amino]benzoic acid?
2-[(2,4-dioxo-1H-pyrimidine-5-carbonyl)amino]benzoic acid has a molecular weight of 275.22 g/mol, XLogP of 0.01, 3 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2,4-dioxo-1H-pyrimidine-5-carbonyl)amino]benzoic acid is sourced from PubChem (CID 28773270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).