C12H8FN3O5 — CID 43442864
2-[(2,4-dioxo-1H-pyrimidine-5-carbonyl)amino]-6-fluorobenzoic acid (PubChem CID 43442864) has the molecular formula C12H8FN3O5 and a molecular weight of 293.21 g/mol. Its IUPAC name is 2-[(2,4-dioxo-1H-pyrimidine-5-carbonyl)amino]-6-fluorobenzoic acid.
| Compound Name | 2-[(2,4-dioxo-1H-pyrimidine-5-carbonyl)amino]-6-fluorobenzoic acid |
|---|---|
| PubChem CID | 43442864 |
| Molecular Formula | C12H8FN3O5 |
| Molecular Weight | 293.21 g/mol |
| Exact Mass | 293.04 |
| IUPAC Name | 2-[(2,4-dioxo-1H-pyrimidine-5-carbonyl)amino]-6-fluorobenzoic acid |
| SMILES | O=C(O)c1c(F)cccc1NC(=O)c1c[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C12H8FN3O5/c13-6-2-1-3-7(8(6)11(19)20)15-9(17)5-4-14-12(21)16-10(5)18/h1-4H,(H,15,17)(H,19,20)(H2,14,16,18,21) |
| InChIKey | GLWUGNFORKUXPI-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 132.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.21 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |