C9H4BrF2N3OS — CID 103842612
N-(4-bromo-2,5-difluorophenyl)thiadiazole-5-carboxamide (PubChem CID 103842612) has the molecular formula C9H4BrF2N3OS and a molecular weight of 320.12 g/mol. Its IUPAC name is N-(4-bromo-2,5-difluorophenyl)thiadiazole-5-carboxamide.
| Compound Name | N-(4-bromo-2,5-difluorophenyl)thiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 103842612 |
| Molecular Formula | C9H4BrF2N3OS |
| Molecular Weight | 320.12 g/mol |
| Exact Mass | 318.92 |
| IUPAC Name | N-(4-bromo-2,5-difluorophenyl)thiadiazole-5-carboxamide |
| SMILES | O=C(Nc1cc(F)c(Br)cc1F)c1cnns1 |
| InChI | InChI=1S/C9H4BrF2N3OS/c10-4-1-6(12)7(2-5(4)11)14-9(16)8-3-13-15-17-8/h1-3H,(H,14,16) |
| InChIKey | XLXWSGJRZYPDPT-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.12 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|