C9H7FN4O3S2 — CID 65215733
N-(5-fluoro-2-sulfamoylphenyl)thiadiazole-5-carboxamide (PubChem CID 65215733) has the molecular formula C9H7FN4O3S2 and a molecular weight of 302.31 g/mol. Its IUPAC name is N-(5-fluoro-2-sulfamoylphenyl)thiadiazole-5-carboxamide.
| Compound Name | N-(5-fluoro-2-sulfamoylphenyl)thiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 65215733 |
| Molecular Formula | C9H7FN4O3S2 |
| Molecular Weight | 302.31 g/mol |
| Exact Mass | 301.99 |
| IUPAC Name | N-(5-fluoro-2-sulfamoylphenyl)thiadiazole-5-carboxamide |
| SMILES | NS(=O)(=O)c1ccc(F)cc1NC(=O)c1cnns1 |
| InChI | InChI=1S/C9H7FN4O3S2/c10-5-1-2-8(19(11,16)17)6(3-5)13-9(15)7-4-12-14-18-7/h1-4H,(H,13,15)(H2,11,16,17) |
| InChIKey | LUJBYCMITUFAAA-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 115.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.31 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |