C13H11FN2O4S — CID 115299526
5-fluoro-2-hydroxy-N-(2-sulfamoylphenyl)benzamide (PubChem CID 115299526) has the molecular formula C13H11FN2O4S and a molecular weight of 310.31 g/mol. Its IUPAC name is 5-fluoro-2-hydroxy-N-(2-sulfamoylphenyl)benzamide.
| Compound Name | 5-fluoro-2-hydroxy-N-(2-sulfamoylphenyl)benzamide |
|---|---|
| PubChem CID | 115299526 |
| Molecular Formula | C13H11FN2O4S |
| Molecular Weight | 310.31 g/mol |
| Exact Mass | 310.04 |
| IUPAC Name | 5-fluoro-2-hydroxy-N-(2-sulfamoylphenyl)benzamide |
| SMILES | NS(=O)(=O)c1ccccc1NC(=O)c1cc(F)ccc1O |
| InChI | InChI=1S/C13H11FN2O4S/c14-8-5-6-11(17)9(7-8)13(18)16-10-3-1-2-4-12(10)21(15,19)20/h1-7,17H,(H,16,18)(H2,15,19,20) |
| InChIKey | QKZVIJNYTBHJNQ-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.31 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |