C21H15FN2O3S — CID 12018921
4-[2-(4-fluorophenyl)ethynyl]-N-(2-sulfamoylphenyl)benzamide (PubChem CID 12018921) has the molecular formula C21H15FN2O3S and a molecular weight of 394.43 g/mol. Its IUPAC name is 4-[2-(4-fluorophenyl)ethynyl]-N-(2-sulfamoylphenyl)benzamide.
| Compound Name | 4-[2-(4-fluorophenyl)ethynyl]-N-(2-sulfamoylphenyl)benzamide |
|---|---|
| PubChem CID | 12018921 |
| Molecular Formula | C21H15FN2O3S |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.08 |
| IUPAC Name | 4-[2-(4-fluorophenyl)ethynyl]-N-(2-sulfamoylphenyl)benzamide |
| SMILES | NS(=O)(=O)c1ccccc1NC(=O)c1ccc(C#Cc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C21H15FN2O3S/c22-18-13-9-16(10-14-18)6-5-15-7-11-17(12-8-15)21(25)24-19-3-1-2-4-20(19)28(23,26)27/h1-4,7-14H,(H,24,25)(H2,23,26,27) |
| InChIKey | GXXGUTBPFIOCPF-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|