C27H23FN2O5S — CID 10142067
4-[2-(4-fluorophenyl)ethynyl]-N-[2-(5-oxohexanoylsulfamoyl)phenyl]benzamide (PubChem CID 10142067) has the molecular formula C27H23FN2O5S and a molecular weight of 506.56 g/mol. Its IUPAC name is 4-[2-(4-fluorophenyl)ethynyl]-N-[2-(5-oxohexanoylsulfamoyl)phenyl]benzamide.
| Compound Name | 4-[2-(4-fluorophenyl)ethynyl]-N-[2-(5-oxohexanoylsulfamoyl)phenyl]benzamide |
|---|---|
| PubChem CID | 10142067 |
| Molecular Formula | C27H23FN2O5S |
| Molecular Weight | 506.56 g/mol |
| Exact Mass | 506.13 |
| IUPAC Name | 4-[2-(4-fluorophenyl)ethynyl]-N-[2-(5-oxohexanoylsulfamoyl)phenyl]benzamide |
| SMILES | CC(=O)CCCC(=O)NS(=O)(=O)c1ccccc1NC(=O)c1ccc(C#Cc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C27H23FN2O5S/c1-19(31)5-4-8-26(32)30-36(34,35)25-7-3-2-6-24(25)29-27(33)22-15-11-20(12-16-22)9-10-21-13-17-23(28)18-14-21/h2-3,6-7,11-18H,4-5,8H2,1H3,(H,29,33)(H,30,32) |
| InChIKey | SUSOVABEAWKUQP-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 109.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.56 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|