C25H26N4O6S — CID 58874798
4-anilino-N-[2-(hexanoylsulfamoyl)phenyl]-3-nitrobenzamide (PubChem CID 58874798) has the molecular formula C25H26N4O6S and a molecular weight of 510.57 g/mol. Its IUPAC name is 4-anilino-N-[2-(hexanoylsulfamoyl)phenyl]-3-nitrobenzamide.
| Compound Name | 4-anilino-N-[2-(hexanoylsulfamoyl)phenyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 58874798 |
| Molecular Formula | C25H26N4O6S |
| Molecular Weight | 510.57 g/mol |
| Exact Mass | 510.16 |
| IUPAC Name | 4-anilino-N-[2-(hexanoylsulfamoyl)phenyl]-3-nitrobenzamide |
| SMILES | CCCCCC(=O)NS(=O)(=O)c1ccccc1NC(=O)c1ccc(Nc2ccccc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C25H26N4O6S/c1-2-3-5-14-24(30)28-36(34,35)23-13-9-8-12-21(23)27-25(31)18-15-16-20(22(17-18)29(32)33)26-19-10-6-4-7-11-19/h4,6-13,15-17,26H,2-3,5,14H2,1H3,(H,27,31)(H,28,30) |
| InChIKey | CQBOZYIUIRFGFK-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 147.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.57 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|