C38H48N2O5S — CID 59057406
N-[2-[[(9Z,12Z)-octadeca-9,12-dienoyl]sulfamoyl]phenyl]-3-phenylmethoxybenzamide (PubChem CID 59057406) has the molecular formula C38H48N2O5S and a molecular weight of 644.88 g/mol. Its IUPAC name is N-[2-[[(9Z,12Z)-octadeca-9,12-dienoyl]sulfamoyl]phenyl]-3-phenylmethoxybenzamide.
| Compound Name | N-[2-[[(9Z,12Z)-octadeca-9,12-dienoyl]sulfamoyl]phenyl]-3-phenylmethoxybenzamide |
|---|---|
| PubChem CID | 59057406 |
| Molecular Formula | C38H48N2O5S |
| Molecular Weight | 644.88 g/mol |
| Exact Mass | 644.33 |
| IUPAC Name | N-[2-[[(9Z,12Z)-octadeca-9,12-dienoyl]sulfamoyl]phenyl]-3-phenylmethoxybenzamide |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)NS(=O)(=O)c1ccccc1NC(=O)c1cccc(OCc2ccccc2)c1 |
| InChI | InChI=1S/C38H48N2O5S/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-19-29-37(41)40-46(43,44)36-28-21-20-27-35(36)39-38(42)33-25-22-26-34(30-33)45-31-32-23-17-16-18-24-32/h6-7,9-10,16-18,20-28,30H,2-5,8,11-15,19,29,31H2,1H3,(H,39,42)(H,40,41)/b7-6-,10-9- |
| InChIKey | SFXYLRVSZBULMM-HZJYTTRNSA-N |
| XLogP | 9.14 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.88 |
| LogP ≤ 5 | 9.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|