C52H50N4O7S2 — CID 158399066
N-[2-(decanoylsulfamoyl)phenyl]-4-(2-phenylethynyl)benzamide;4-(2-phenylethynyl)-N-(2-sulfamoylphenyl)benzamide (PubChem CID 158399066) has the molecular formula C52H50N4O7S2 and a molecular weight of 907.13 g/mol. Its IUPAC name is N-[2-(decanoylsulfamoyl)phenyl]-4-(2-phenylethynyl)benzamide;4-(2-phenylethynyl)-N-(2-sulfamoylphenyl)benzamide.
| Compound Name | N-[2-(decanoylsulfamoyl)phenyl]-4-(2-phenylethynyl)benzamide;4-(2-phenylethynyl)-N-(2-sulfamoylphenyl)benzamide |
|---|---|
| PubChem CID | 158399066 |
| Molecular Formula | C52H50N4O7S2 |
| Molecular Weight | 907.13 g/mol |
| Exact Mass | 906.31 |
| IUPAC Name | N-[2-(decanoylsulfamoyl)phenyl]-4-(2-phenylethynyl)benzamide;4-(2-phenylethynyl)-N-(2-sulfamoylphenyl)benzamide |
| SMILES | CCCCCCCCCC(=O)NS(=O)(=O)c1ccccc1NC(=O)c1ccc(C#Cc2ccccc2)cc1.NS(=O)(=O)c1ccccc1NC(=O)c1ccc(C#Cc2ccccc2)cc1 |
| InChI | InChI=1S/C31H34N2O4S.C21H16N2O3S/c1-2-3-4-5-6-7-11-18-30(34)33-38(36,37)29-17-13-12-16-28(29)32-31(35)27-23-21-26(22-24-27)20-19-25-14-9-8-10-15-25;22-27(25,26)20-9-5-4-8-19(20)23-21(24)18-14-12-17(13-15-18)11-10-16-6-2-1-3-7-16/h8-10,12-17,21-24H,2-7,11,18H2,1H3,(H,32,35)(H,33,34);1-9,12-15H,(H,23,24)(H2,22,25,26) |
| InChIKey | GXWMDQNNZOLBBR-UHFFFAOYSA-N |
| XLogP | 9.27 |
| TPSA | 181.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 907.13 |
| LogP ≤ 5 | 9.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|