C28H25F3N2O5S — CID 10303046
N-[2-(hexanoylsulfamoyl)phenyl]-4-[2-[4-(trifluoromethoxy)phenyl]ethynyl]benzamide (PubChem CID 10303046) has the molecular formula C28H25F3N2O5S and a molecular weight of 558.58 g/mol. Its IUPAC name is N-[2-(hexanoylsulfamoyl)phenyl]-4-[2-[4-(trifluoromethoxy)phenyl]ethynyl]benzamide.
| Compound Name | N-[2-(hexanoylsulfamoyl)phenyl]-4-[2-[4-(trifluoromethoxy)phenyl]ethynyl]benzamide |
|---|---|
| PubChem CID | 10303046 |
| Molecular Formula | C28H25F3N2O5S |
| Molecular Weight | 558.58 g/mol |
| Exact Mass | 558.14 |
| IUPAC Name | N-[2-(hexanoylsulfamoyl)phenyl]-4-[2-[4-(trifluoromethoxy)phenyl]ethynyl]benzamide |
| SMILES | CCCCCC(=O)NS(=O)(=O)c1ccccc1NC(=O)c1ccc(C#Cc2ccc(OC(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C28H25F3N2O5S/c1-2-3-4-9-26(34)33-39(36,37)25-8-6-5-7-24(25)32-27(35)22-16-12-20(13-17-22)10-11-21-14-18-23(19-15-21)38-28(29,30)31/h5-8,12-19H,2-4,9H2,1H3,(H,32,35)(H,33,34) |
| InChIKey | ABBGYESRWCPXGU-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.58 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|