C22H15F3N2O4S — CID 12018920
N-(2-sulfamoylphenyl)-4-[2-[4-(trifluoromethoxy)phenyl]ethynyl]benzamide (PubChem CID 12018920) has the molecular formula C22H15F3N2O4S and a molecular weight of 460.43 g/mol. Its IUPAC name is N-(2-sulfamoylphenyl)-4-[2-[4-(trifluoromethoxy)phenyl]ethynyl]benzamide.
| Compound Name | N-(2-sulfamoylphenyl)-4-[2-[4-(trifluoromethoxy)phenyl]ethynyl]benzamide |
|---|---|
| PubChem CID | 12018920 |
| Molecular Formula | C22H15F3N2O4S |
| Molecular Weight | 460.43 g/mol |
| Exact Mass | 460.07 |
| IUPAC Name | N-(2-sulfamoylphenyl)-4-[2-[4-(trifluoromethoxy)phenyl]ethynyl]benzamide |
| SMILES | NS(=O)(=O)c1ccccc1NC(=O)c1ccc(C#Cc2ccc(OC(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C22H15F3N2O4S/c23-22(24,25)31-18-13-9-16(10-14-18)6-5-15-7-11-17(12-8-15)21(28)27-19-3-1-2-4-20(19)32(26,29)30/h1-4,7-14H,(H,27,28)(H2,26,29,30) |
| InChIKey | YDRDRHBXFQNDMQ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.43 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|