C21H14F3NO4 — CID 67342853
2-benzamido-4-[4-(trifluoromethoxy)phenyl]benzoic acid (PubChem CID 67342853) has the molecular formula C21H14F3NO4 and a molecular weight of 401.34 g/mol. Its IUPAC name is 2-benzamido-4-[4-(trifluoromethoxy)phenyl]benzoic acid.
| Compound Name | 2-benzamido-4-[4-(trifluoromethoxy)phenyl]benzoic acid |
|---|---|
| PubChem CID | 67342853 |
| Molecular Formula | C21H14F3NO4 |
| Molecular Weight | 401.34 g/mol |
| Exact Mass | 401.09 |
| IUPAC Name | 2-benzamido-4-[4-(trifluoromethoxy)phenyl]benzoic acid |
| SMILES | O=C(Nc1cc(-c2ccc(OC(F)(F)F)cc2)ccc1C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C21H14F3NO4/c22-21(23,24)29-16-9-6-13(7-10-16)15-8-11-17(20(27)28)18(12-15)25-19(26)14-4-2-1-3-5-14/h1-12H,(H,25,26)(H,27,28) |
| InChIKey | IJPTYXGQQGEYLU-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.34 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |