2-benzamido-4-(3,4-difluorophenyl)benzoic acid

C20H13F2NO3 — CID 67342195

IUPAC2-benzamido-4-(3,4-difluorophenyl)benzoic acid
SMILESO=C(Nc1cc(-c2ccc(F)c(F)c2)ccc1C(=O)O)c1ccccc1
InChIInChI=1S/C20H13F2NO3/c21-16-9-7-13(10-17(16)22)14-6-8-15(20(25)26)18(11-14)23-19(24)12-4-2-1-3-5-12/h1-11H,(H,23,24)(H,25,26)
InChIKeyILUCVIJFBUFTDH-UHFFFAOYSA-N
MW353.32 g/mol
LogP4.58
Rot. Bonds4

About 2-benzamido-4-(3,4-difluorophenyl)benzoic acid

2-benzamido-4-(3,4-difluorophenyl)benzoic acid (PubChem CID 67342195) has the molecular formula C20H13F2NO3 and a molecular weight of 353.32 g/mol. Its IUPAC name is 2-benzamido-4-(3,4-difluorophenyl)benzoic acid.

Molecular Properties

Compound Name2-benzamido-4-(3,4-difluorophenyl)benzoic acid
PubChem CID67342195
Molecular FormulaC20H13F2NO3
Molecular Weight353.32 g/mol
Exact Mass353.09
IUPAC Name2-benzamido-4-(3,4-difluorophenyl)benzoic acid
SMILESO=C(Nc1cc(-c2ccc(F)c(F)c2)ccc1C(=O)O)c1ccccc1
InChIInChI=1S/C20H13F2NO3/c21-16-9-7-13(10-17(16)22)14-6-8-15(20(25)26)18(11-14)23-19(24)12-4-2-1-3-5-12/h1-11H,(H,23,24)(H,25,26)
InChIKeyILUCVIJFBUFTDH-UHFFFAOYSA-N
XLogP4.58
TPSA66.40 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms26
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500353.32
LogP ≤ 54.58
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2-benzamido-4-(3,4-difluorophenyl)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-benzamido-4-(3,4-difluorophenyl)benzoic acid?
The IUPAC name of 2-benzamido-4-(3,4-difluorophenyl)benzoic acid (CID 67342195) is 2-benzamido-4-(3,4-difluorophenyl)benzoic acid.
What is the SMILES notation for 2-benzamido-4-(3,4-difluorophenyl)benzoic acid?
The canonical SMILES for 2-benzamido-4-(3,4-difluorophenyl)benzoic acid is O=C(Nc1cc(-c2ccc(F)c(F)c2)ccc1C(=O)O)c1ccccc1.
What is the InChIKey of 2-benzamido-4-(3,4-difluorophenyl)benzoic acid?
The InChIKey is ILUCVIJFBUFTDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H13F2NO3/c21-16-9-7-13(10-17(16)22)14-6-8-15(20(25)26)18(11-14)23-19(24)12-4-2-1-3-5-12/h1-11H,(H,23,24)(H,25,26).
What are the key properties of 2-benzamido-4-(3,4-difluorophenyl)benzoic acid?
2-benzamido-4-(3,4-difluorophenyl)benzoic acid has a molecular weight of 353.32 g/mol, XLogP of 4.58, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzamido-4-(3,4-difluorophenyl)benzoic acid is sourced from PubChem (CID 67342195), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).