C24H18F2N2O7S — CID 156789338
2-[[2-carboxy-4-[(methyl-methylidene-oxo-λ6-sulfanyl)carbamoyl]benzoyl]amino]-4-(3,4-difluorophenyl)benzoic acid (PubChem CID 156789338) has the molecular formula C24H18F2N2O7S and a molecular weight of 516.48 g/mol. Its IUPAC name is 2-[[2-carboxy-4-[(methyl-methylidene-oxo-λ6-sulfanyl)carbamoyl]benzoyl]amino]-4-(3,4-difluorophenyl)benzoic acid.
| Compound Name | 2-[[2-carboxy-4-[(methyl-methylidene-oxo-λ6-sulfanyl)carbamoyl]benzoyl]amino]-4-(3,4-difluorophenyl)benzoic acid |
|---|---|
| PubChem CID | 156789338 |
| Molecular Formula | C24H18F2N2O7S |
| Molecular Weight | 516.48 g/mol |
| Exact Mass | 516.08 |
| IUPAC Name | 2-[[2-carboxy-4-[(methyl-methylidene-oxo-λ6-sulfanyl)carbamoyl]benzoyl]amino]-4-(3,4-difluorophenyl)benzoic acid |
| SMILES | C=S(C)(=O)NC(=O)c1ccc(C(=O)Nc2cc(-c3ccc(F)c(F)c3)ccc2C(=O)O)c(C(=O)O)c1 |
| InChI | InChI=1S/C24H18F2N2O7S/c1-36(2,35)28-21(29)14-4-6-15(17(9-14)24(33)34)22(30)27-20-11-13(3-7-16(20)23(31)32)12-5-8-18(25)19(26)10-12/h3-11H,1H2,2H3,(H,27,30)(H,31,32)(H,33,34)(H,28,29,35) |
| InChIKey | CMESWTCAGFDUCP-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 149.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.48 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|