C23H17N3O3 — CID 67343979
4-phenyl-2-[(3-phenyl-1H-pyrazole-5-carbonyl)amino]benzoic acid (PubChem CID 67343979) has the molecular formula C23H17N3O3 and a molecular weight of 383.41 g/mol. Its IUPAC name is 4-phenyl-2-[(3-phenyl-1H-pyrazole-5-carbonyl)amino]benzoic acid.
| Compound Name | 4-phenyl-2-[(3-phenyl-1H-pyrazole-5-carbonyl)amino]benzoic acid |
|---|---|
| PubChem CID | 67343979 |
| Molecular Formula | C23H17N3O3 |
| Molecular Weight | 383.41 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | 4-phenyl-2-[(3-phenyl-1H-pyrazole-5-carbonyl)amino]benzoic acid |
| SMILES | O=C(Nc1cc(-c2ccccc2)ccc1C(=O)O)c1cc(-c2ccccc2)n[nH]1 |
| InChI | InChI=1S/C23H17N3O3/c27-22(21-14-19(25-26-21)16-9-5-2-6-10-16)24-20-13-17(11-12-18(20)23(28)29)15-7-3-1-4-8-15/h1-14H,(H,24,27)(H,25,26)(H,28,29) |
| InChIKey | BDWQDRVMOMZLKV-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.41 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |